cervical thymus
A mature thymus that is entirely part of the cervical region. [ https://orcid.org/0000-0002-6601-2165 ]
Term info
organ_slim
A cervical thymus is a pathological structure in a human - it can form during the migration of the thymus to its location in the mediastinum. Some mice have a cervical thymus. There are examples of cervical thymi in marsupials and prosimians[ISBN:0781714125]
uberon
UBERON:0009114
http://purl.obolibrary.org/obo/NCBITaxon_39107, http://purl.obolibrary.org/obo/NCBITaxon_9263